C27H40O9 — CID 163162934
methyl 9,10-dihydroxy-2-(2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl)-2,4b,8,8,10a-pentamethyl-3-methylidene-7-oxo-1,4,4a,5,6,8a,9,10-octahydrophenanthrene-1-carboxylate (PubChem CID 163162934) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is methyl 9,10-dihydroxy-2-(2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl)-2,4b,8,8,10a-pentamethyl-3-methylidene-7-oxo-1,4,4a,5,6,8a,9,10-octahydrophenanthrene-1-carboxylate.
| Compound Name | methyl 9,10-dihydroxy-2-(2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl)-2,4b,8,8,10a-pentamethyl-3-methylidene-7-oxo-1,4,4a,5,6,8a,9,10-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 163162934 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | methyl 9,10-dihydroxy-2-(2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl)-2,4b,8,8,10a-pentamethyl-3-methylidene-7-oxo-1,4,4a,5,6,8a,9,10-octahydrophenanthrene-1-carboxylate |
| SMILES | C=C1CC2C3(C)CCC(=O)C(C)(C)C3C(O)C(O)C2(C)C(C(=O)OC)C1(C)C(=O)C(C)(O)C(=O)OC |
| InChI | InChI=1S/C27H40O9/c1-13-12-14-24(4)11-10-15(28)23(2,3)17(24)16(29)19(30)26(14,6)18(20(31)35-8)25(13,5)21(32)27(7,34)22(33)36-9/h14,16-19,29-30,34H,1,10-12H2,2-9H3 |
| InChIKey | RQDRZUCSMAVYPX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|