C12H20N2O — CID 163163539
2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-4-one (PubChem CID 163163539) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-4-one.
| Compound Name | 2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 163163539 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2,3,4a,5,6,6a,7,8,9,10,10a,10b-dodecahydro-1H-benzo[h][1,6]naphthyridin-4-one |
| SMILES | O=C1CCNC2C1CNC1CCCCC12 |
| InChI | InChI=1S/C12H20N2O/c15-11-5-6-13-12-8-3-1-2-4-10(8)14-7-9(11)12/h8-10,12-14H,1-7H2 |
| InChIKey | ZVQSFJIUNWSBCF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |