C16H14N7O3- — CID 163163853
[4-[(3,5-diamino-1-benzoylpyrazol-4-yl)hydrazinylidene]cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium (PubChem CID 163163853) has the molecular formula C16H14N7O3- and a molecular weight of 352.33 g/mol. Its IUPAC name is [4-[(3,5-diamino-1-benzoylpyrazol-4-yl)hydrazinylidene]cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium.
| Compound Name | [4-[(3,5-diamino-1-benzoylpyrazol-4-yl)hydrazinylidene]cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium |
|---|---|
| PubChem CID | 163163853 |
| Molecular Formula | C16H14N7O3- |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [4-[(3,5-diamino-1-benzoylpyrazol-4-yl)hydrazinylidene]cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium |
| SMILES | Nc1nn(C(=O)c2ccccc2)c(N)c1NN=C1C=CC(=[N+]([O-])[O-])C=C1 |
| InChI | InChI=1S/C16H14N7O3/c17-14-13(20-19-11-6-8-12(9-7-11)23(25)26)15(18)22(21-14)16(24)10-4-2-1-3-5-10/h1-9,20H,(H4-,17,18,19,21,25,26)/q-1 |
| InChIKey | CDUUCRXMKKVAKW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|