C20H34ClN3O2S — CID 163163882
methyl 3-[(4-chlorocyclohexyl)methyl]-5-(thiolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 163163882) has the molecular formula C20H34ClN3O2S and a molecular weight of 416.03 g/mol. Its IUPAC name is methyl 3-[(4-chlorocyclohexyl)methyl]-5-(thiolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-[(4-chlorocyclohexyl)methyl]-5-(thiolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 163163882 |
| Molecular Formula | C20H34ClN3O2S |
| Molecular Weight | 416.03 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl 3-[(4-chlorocyclohexyl)methyl]-5-(thiolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)C1CC2NCN(CC3CCC(Cl)CC3)C2CN1CC1CCCS1 |
| InChI | InChI=1S/C20H34ClN3O2S/c1-26-20(25)18-9-17-19(12-23(18)11-16-3-2-8-27-16)24(13-22-17)10-14-4-6-15(21)7-5-14/h14-19,22H,2-13H2,1H3 |
| InChIKey | JMGRVXGRHDKOLO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.03 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|