C26H44N5O+ — CID 163164398
(1R,4aR,5S,6R,8aS)-5-[(E)-5-(6-amino-9-methyl-8,9-dihydropurin-9-ium-7-yl)-3-methylpent-3-enyl]-1,5,6,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-ol (PubChem CID 163164398) has the molecular formula C26H44N5O+ and a molecular weight of 442.67 g/mol. Its IUPAC name is (1R,4aR,5S,6R,8aS)-5-[(E)-5-(6-amino-9-methyl-8,9-dihydropurin-9-ium-7-yl)-3-methylpent-3-enyl]-1,5,6,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | (1R,4aR,5S,6R,8aS)-5-[(E)-5-(6-amino-9-methyl-8,9-dihydropurin-9-ium-7-yl)-3-methylpent-3-enyl]-1,5,6,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 163164398 |
| Molecular Formula | C26H44N5O+ |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.35 |
| IUPAC Name | (1R,4aR,5S,6R,8aS)-5-[(E)-5-(6-amino-9-methyl-8,9-dihydropurin-9-ium-7-yl)-3-methylpent-3-enyl]-1,5,6,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-ol |
| SMILES | C/C(=C\CN1C[NH+](C)c2ncnc(N)c21)CC[C@@]1(C)[C@H](C)CC[C@@]2(C)[C@H](C)CCC[C@]12O |
| InChI | InChI=1S/C26H43N5O/c1-18(11-15-31-17-30(6)23-21(31)22(27)28-16-29-23)9-13-24(4)20(3)10-14-25(5)19(2)8-7-12-26(24,25)32/h11,16,19-20,32H,7-10,12-15,17H2,1-6H3,(H2,27,28,29)/p+1/b18-11+/t19-,20-,24+,25+,26+/m1/s1 |
| InChIKey | SEABLBDFLWXDKA-CVZSUYSJSA-O |
| XLogP | 3.70 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|