C19H20O3 — CID 163166197
9-methyl-5-propan-2-yl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-1,4,6,13(16)-tetraene-3,14-dione (PubChem CID 163166197) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 9-methyl-5-propan-2-yl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-1,4,6,13(16)-tetraene-3,14-dione.
| Compound Name | 9-methyl-5-propan-2-yl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-1,4,6,13(16)-tetraene-3,14-dione |
|---|---|
| PubChem CID | 163166197 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 9-methyl-5-propan-2-yl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadeca-1,4,6,13(16)-tetraene-3,14-dione |
| SMILES | CC(C)C1=CC(=O)C2=C3OC(=O)C4=C3C(C)(CC=C12)CCC4 |
| InChI | InChI=1S/C19H20O3/c1-10(2)13-9-14(20)15-11(13)6-8-19(3)7-4-5-12-16(19)17(15)22-18(12)21/h6,9-10H,4-5,7-8H2,1-3H3 |
| InChIKey | SUVNZKPKTKQRDF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |