About 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide
4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide (PubChem CID 163166433) has the molecular formula C15H29N2O3+
and a molecular weight of 285.41 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide.
Molecular Properties
| Compound Name | 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide |
| PubChem CID | 163166433 |
| Molecular Formula | C15H29N2O3+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide |
| SMILES | CC1CC[NH+](CC(=O)C2CCC([NH+]([O-])O)CC2)C(C)C1 |
| InChI | InChI=1S/C15H28N2O3/c1-11-7-8-16(12(2)9-11)10-15(18)13-3-5-14(6-4-13)17(19)20/h11-14,17,19H,3-10H2,1-2H3/p+1 |
| InChIKey | AAKYTOUIXVDKMV-UHFFFAOYSA-O |
| XLogP | -0.41 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide?
The IUPAC name of 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide (CID 163166433) is 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide.
What is the SMILES notation for 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide?
The canonical SMILES for 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide is CC1CC[NH+](CC(=O)C2CCC([NH+]([O-])O)CC2)C(C)C1.
What is the InChIKey of 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide?
The InChIKey is AAKYTOUIXVDKMV-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H28N2O3/c1-11-7-8-16(12(2)9-11)10-15(18)13-3-5-14(6-4-13)17(19)20/h11-14,17,19H,3-10H2,1-2H3/p+1.
What are the key properties of 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide?
4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide has a molecular weight of 285.41 g/mol, XLogP of -0.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dimethylpiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide is sourced from PubChem (CID 163166433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).