About 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline
3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline (PubChem CID 163167040) has the molecular formula C12H9ClN2O4-2
and a molecular weight of 280.67 g/mol. Its IUPAC name is 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline.
Molecular Properties
| Compound Name | 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline |
| PubChem CID | 163167040 |
| Molecular Formula | C12H9ClN2O4-2 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline |
| SMILES | [O-]N([O-])c1ccc(-c2ccc(N(O)O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C12H9ClN2O4/c13-12-7-10(15(18)19)5-6-11(12)8-1-3-9(4-2-8)14(16)17/h1-7,16-17H/q-2 |
| InChIKey | NLCLQJBSVWGGJT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline?
The IUPAC name of 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline (CID 163167040) is 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline.
What is the SMILES notation for 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline?
The canonical SMILES for 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline is [O-]N([O-])c1ccc(-c2ccc(N(O)O)cc2)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline?
The InChIKey is NLCLQJBSVWGGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClN2O4/c13-12-7-10(15(18)19)5-6-11(12)8-1-3-9(4-2-8)14(16)17/h1-7,16-17H/q-2.
What are the key properties of 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline?
3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline has a molecular weight of 280.67 g/mol, XLogP of 3.39, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[4-(dihydroxyamino)phenyl]-N,N-dioxidoaniline is sourced from PubChem (CID 163167040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).