C26H40O5 — CID 163167406
3-(14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl)-4-hydroxy-6-methylpyran-2-one (PubChem CID 163167406) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 3-(14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl)-4-hydroxy-6-methylpyran-2-one.
| Compound Name | 3-(14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl)-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 163167406 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 3-(14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl)-4-hydroxy-6-methylpyran-2-one |
| SMILES | CC(=CCCC(C)=CCc1c(O)cc(C)oc1=O)CCC=C(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C26H40O5/c1-18(10-8-12-20(3)14-16-24(28)26(5,6)30)9-7-11-19(2)13-15-22-23(27)17-21(4)31-25(22)29/h9,12-13,17,24,27-28,30H,7-8,10-11,14-16H2,1-6H3 |
| InChIKey | TZQLBRHWARFZKE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|