C13H20N4O5 — CID 163167528
[(1R,5R)-2-[[2,4-bis(dihydroxyamino)phenyl]hydrazinylidene]-5-methylcyclopentyl]methanol (PubChem CID 163167528) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is [(1R,5R)-2-[[2,4-bis(dihydroxyamino)phenyl]hydrazinylidene]-5-methylcyclopentyl]methanol.
| Compound Name | [(1R,5R)-2-[[2,4-bis(dihydroxyamino)phenyl]hydrazinylidene]-5-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 163167528 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(1R,5R)-2-[[2,4-bis(dihydroxyamino)phenyl]hydrazinylidene]-5-methylcyclopentyl]methanol |
| SMILES | C[C@@H]1CCC(=NNc2ccc(N(O)O)cc2N(O)O)[C@@H]1CO |
| InChI | InChI=1S/C13H20N4O5/c1-8-2-4-11(10(8)7-18)14-15-12-5-3-9(16(19)20)6-13(12)17(21)22/h3,5-6,8,10,15,18-22H,2,4,7H2,1H3/t8-,10-/m1/s1 |
| InChIKey | UBAVXMDABFPTGS-PSASIEDQSA-N |
| XLogP | 1.66 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|