C18H31N3O4S — CID 163167616
7-[(1S)-6,7-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrimido[2,1-b][1,3]thiazin-9-ium-8-olate (PubChem CID 163167616) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is 7-[(1S)-6,7-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrimido[2,1-b][1,3]thiazin-9-ium-8-olate.
| Compound Name | 7-[(1S)-6,7-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrimido[2,1-b][1,3]thiazin-9-ium-8-olate |
|---|---|
| PubChem CID | 163167616 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 7-[(1S)-6,7-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrimido[2,1-b][1,3]thiazin-9-ium-8-olate |
| SMILES | COC1CC2CCN[C@H](C3C(=O)N4CCCSC4[NH2+]C3[O-])C2CC1OC |
| InChI | InChI=1S/C18H30N3O4S/c1-24-12-8-10-4-5-19-15(11(10)9-13(12)25-2)14-16(22)20-18-21(17(14)23)6-3-7-26-18/h10-16,18-20H,3-9H2,1-2H3/q-1/p+1/t10?,11?,12?,13?,14?,15-,16?,18?/m0/s1 |
| InChIKey | AHOIVSBBAPZCJW-JQIMJPTGSA-O |
| XLogP | -1.47 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |