C44H61NO5S2 — CID 163168244
5-[14-hydroxy-7-methyl-11-[(3-pentylphenyl)methyl]spiro[5-oxa-22,23-dithia-25-azapentacyclo[11.11.1.04,8.09,25.016,20]pentacos-3-ene-17,1'-cyclopentane]-6-ylidene]-4-methoxy-3-methylfuran-2-one (PubChem CID 163168244) has the molecular formula C44H61NO5S2 and a molecular weight of 748.11 g/mol. Its IUPAC name is 5-[14-hydroxy-7-methyl-11-[(3-pentylphenyl)methyl]spiro[5-oxa-22,23-dithia-25-azapentacyclo[11.11.1.04,8.09,25.016,20]pentacos-3-ene-17,1'-cyclopentane]-6-ylidene]-4-methoxy-3-methylfuran-2-one.
| Compound Name | 5-[14-hydroxy-7-methyl-11-[(3-pentylphenyl)methyl]spiro[5-oxa-22,23-dithia-25-azapentacyclo[11.11.1.04,8.09,25.016,20]pentacos-3-ene-17,1'-cyclopentane]-6-ylidene]-4-methoxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 163168244 |
| Molecular Formula | C44H61NO5S2 |
| Molecular Weight | 748.11 g/mol |
| Exact Mass | 747.40 |
| IUPAC Name | 5-[14-hydroxy-7-methyl-11-[(3-pentylphenyl)methyl]spiro[5-oxa-22,23-dithia-25-azapentacyclo[11.11.1.04,8.09,25.016,20]pentacos-3-ene-17,1'-cyclopentane]-6-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES | CCCCCc1cccc(CC2CC3C(O)CC4C(CCC45CCCC5)CSSCC4CC=C5OC(=C6OC(=O)C(C)=C6OC)C(C)C5C(C2)N43)c1 |
| InChI | InChI=1S/C44H61NO5S2/c1-5-6-7-11-29-12-10-13-30(20-29)21-31-22-35-37(46)24-34-32(16-19-44(34)17-8-9-18-44)25-51-52-26-33-14-15-38-39(36(23-31)45(33)35)27(2)41(49-38)42-40(48-4)28(3)43(47)50-42/h10,12-13,15,20,27,31-37,39,46H,5-9,11,14,16-19,21-26H2,1-4H3 |
| InChIKey | UHIADCSWPPTJSQ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.11 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|