C31H46N4O3S — CID 163168855
(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(3S)-2,4,4,9-tetramethyl-1,3-dihydropyrido[3,4-b]indole-3-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid (PubChem CID 163168855) has the molecular formula C31H46N4O3S and a molecular weight of 554.80 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(3S)-2,4,4,9-tetramethyl-1,3-dihydropyrido[3,4-b]indole-3-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid.
| Compound Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(3S)-2,4,4,9-tetramethyl-1,3-dihydropyrido[3,4-b]indole-3-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid |
|---|---|
| PubChem CID | 163168855 |
| Molecular Formula | C31H46N4O3S |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(3S)-2,4,4,9-tetramethyl-1,3-dihydropyrido[3,4-b]indole-3-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enethioic S-acid |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H]1N(C)Cc2c(c3ccccc3n2C)C1(C)C)C(C)(C)C)C(=O)S |
| InChI | InChI=1S/C31H46N4O3S/c1-18(2)22(16-19(3)29(38)39)35(11)28(37)25(30(4,5)6)32-27(36)26-31(7,8)24-20-14-12-13-15-21(20)34(10)23(24)17-33(26)9/h12-16,18,22,25-26H,17H2,1-11H3,(H,32,36)(H,38,39)/b19-16+/t22-,25-,26-/m1/s1 |
| InChIKey | UNRDSLMUXSYSDH-CZMXCUEVSA-N |
| XLogP | 4.69 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|