C24H25BrN4O2 — CID 163169016
8-bromo-3-[[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]pyrimido[5,4-b]indole-2,4-dione (PubChem CID 163169016) has the molecular formula C24H25BrN4O2 and a molecular weight of 481.39 g/mol. Its IUPAC name is 8-bromo-3-[[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]pyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 8-bromo-3-[[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]pyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 163169016 |
| Molecular Formula | C24H25BrN4O2 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 8-bromo-3-[[(1S,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]pyrimido[5,4-b]indole-2,4-dione |
| SMILES | CC(C)=CCCC1=CC[C@H](C=NN2C(=O)N=C3C(=Nc4ccc(Br)cc43)C2=O)[C@H](C)C1 |
| InChI | InChI=1S/C24H25BrN4O2/c1-14(2)5-4-6-16-7-8-17(15(3)11-16)13-26-29-23(30)22-21(28-24(29)31)19-12-18(25)9-10-20(19)27-22/h5,7,9-10,12-13,15,17H,4,6,8,11H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | UPKMLOKGYHFXLY-NVXWUHKLSA-N |
| XLogP | 5.99 |
| TPSA | 74.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|