C26H49N2O6+ — CID 163169062
[(3R,5S)-3-acetyloxy-1-[2-(2-aminopiperidin-1-ium-4-yl)-4-hydroxy-5-methoxycyclohexyl]decan-5-yl] acetate (PubChem CID 163169062) has the molecular formula C26H49N2O6+ and a molecular weight of 485.69 g/mol. Its IUPAC name is [(3R,5S)-3-acetyloxy-1-[2-(2-aminopiperidin-1-ium-4-yl)-4-hydroxy-5-methoxycyclohexyl]decan-5-yl] acetate.
| Compound Name | [(3R,5S)-3-acetyloxy-1-[2-(2-aminopiperidin-1-ium-4-yl)-4-hydroxy-5-methoxycyclohexyl]decan-5-yl] acetate |
|---|---|
| PubChem CID | 163169062 |
| Molecular Formula | C26H49N2O6+ |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.36 |
| IUPAC Name | [(3R,5S)-3-acetyloxy-1-[2-(2-aminopiperidin-1-ium-4-yl)-4-hydroxy-5-methoxycyclohexyl]decan-5-yl] acetate |
| SMILES | CCCCC[C@@H](C[C@@H](CCC1CC(OC)C(O)CC1C1CC[NH2+]C(N)C1)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C26H48N2O6/c1-5-6-7-8-21(33-17(2)29)15-22(34-18(3)30)10-9-19-13-25(32-4)24(31)16-23(19)20-11-12-28-26(27)14-20/h19-26,28,31H,5-16,27H2,1-4H3/p+1/t19?,20?,21-,22+,23?,24?,25?,26?/m0/s1 |
| InChIKey | UKFCKUSEWNQQPV-PAEWNJKESA-O |
| XLogP | 2.26 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|