C17H20N2O6 — CID 163169780
(2R,4E)-4-[2-[2-(3,4-dihydroxyphenyl)ethylamino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 163169780) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (2R,4E)-4-[2-[2-(3,4-dihydroxyphenyl)ethylamino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | (2R,4E)-4-[2-[2-(3,4-dihydroxyphenyl)ethylamino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 163169780 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2R,4E)-4-[2-[2-(3,4-dihydroxyphenyl)ethylamino]ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1=C/C(=C/CNCCc2ccc(O)c(O)c2)C[C@H](C(=O)O)N1 |
| InChI | InChI=1S/C17H20N2O6/c20-14-2-1-10(9-15(14)21)3-5-18-6-4-11-7-12(16(22)23)19-13(8-11)17(24)25/h1-2,4,7,9,13,18-21H,3,5-6,8H2,(H,22,23)(H,24,25)/b11-4-/t13-/m1/s1 |
| InChIKey | FWIRFVSGAQDPDL-XFVCYKSVSA-N |
| XLogP | 0.57 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|