C16H19N3O4 — CID 163169997
(4aS,7aS)-3-benzyl-5-(2-methoxyacetyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 163169997) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is (4aS,7aS)-3-benzyl-5-(2-methoxyacetyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7aS)-3-benzyl-5-(2-methoxyacetyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163169997 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4aS,7aS)-3-benzyl-5-(2-methoxyacetyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | COCC(=O)N1CC[C@@H]2NC(=O)N(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C16H19N3O4/c1-23-10-13(20)18-8-7-12-14(18)15(21)19(16(22)17-12)9-11-5-3-2-4-6-11/h2-6,12,14H,7-10H2,1H3,(H,17,22)/t12-,14-/m0/s1 |
| InChIKey | UYUPLPOMWFKCLZ-JSGCOSHPSA-N |
| XLogP | 0.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |