C23H41N3O2S — CID 163170280
2-[5-[7-hydroxy-4-isothiocyanato-8-(methanidylazaniumyl)-4,7-dimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methanidylazanium (PubChem CID 163170280) has the molecular formula C23H41N3O2S and a molecular weight of 423.67 g/mol. Its IUPAC name is 2-[5-[7-hydroxy-4-isothiocyanato-8-(methanidylazaniumyl)-4,7-dimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methanidylazanium.
| Compound Name | 2-[5-[7-hydroxy-4-isothiocyanato-8-(methanidylazaniumyl)-4,7-dimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methanidylazanium |
|---|---|
| PubChem CID | 163170280 |
| Molecular Formula | C23H41N3O2S |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 2-[5-[7-hydroxy-4-isothiocyanato-8-(methanidylazaniumyl)-4,7-dimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methanidylazanium |
| SMILES | [CH2-][NH2+]C1C2C(CCC1(C)O)C(C)(N=C=S)CCC2C1(C)CCC(C(C)(C)[NH2+][CH2-])O1 |
| InChI | InChI=1S/C23H41N3O2S/c1-20(2,25-7)17-10-13-23(5,28-17)16-8-11-21(3,26-14-29)15-9-12-22(4,27)19(24-6)18(15)16/h15-19,27H,6-13,24-25H2,1-5H3 |
| InChIKey | VBYHUBFKOBXXGW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|