C7H6N3O2S- — CID 163173457
N-(2-amino-1,3-benzothiazol-6-yl)-N-oxidohydroxylamine (PubChem CID 163173457) has the molecular formula C7H6N3O2S- and a molecular weight of 196.21 g/mol. Its IUPAC name is N-(2-amino-1,3-benzothiazol-6-yl)-N-oxidohydroxylamine.
| Compound Name | N-(2-amino-1,3-benzothiazol-6-yl)-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163173457 |
| Molecular Formula | C7H6N3O2S- |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | N-(2-amino-1,3-benzothiazol-6-yl)-N-oxidohydroxylamine |
| SMILES | Nc1nc2ccc(N([O-])O)cc2s1 |
| InChI | InChI=1S/C7H6N3O2S/c8-7-9-5-2-1-4(10(11)12)3-6(5)13-7/h1-3,11H,(H2,8,9)/q-1 |
| InChIKey | GICKPDRCPFPTRZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|