C9H4F11NO3 — CID 163174544
2-cyanoethyl (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 163174544) has the molecular formula C9H4F11NO3 and a molecular weight of 383.11 g/mol. Its IUPAC name is 2-cyanoethyl (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | 2-cyanoethyl (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 163174544 |
| Molecular Formula | C9H4F11NO3 |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2-cyanoethyl (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | N#CCCOC(=O)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4F11NO3/c10-5(7(13,14)15,4(22)23-3-1-2-21)24-9(19,20)6(11,12)8(16,17)18/h1,3H2/t5-/m1/s1 |
| InChIKey | WSMMAUVBQHJOHH-RXMQYKEDSA-N |
| XLogP | 3.48 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|