C43H64N3O7+ — CID 163174835
CID 163174835 (PubChem CID 163174835) has the molecular formula C43H64N3O7+ and a molecular weight of 735.00 g/mol.
| Compound Name | CID 163174835 |
|---|---|
| PubChem CID | 163174835 |
| Molecular Formula | C43H64N3O7+ |
| Molecular Weight | 735.00 g/mol |
| Exact Mass | 734.47 |
| IUPAC Name | — |
| SMILES | C[C@H](O)CNC[C@H]1C2=C[C+]([C@@H](O)COc3cc(CC[C-]4C=C(CO)C(CCCCCC[C@H](N)CCCO)[OH+]4)ccc3O)N=C2[C@H]2C=C[C@@]13CCC[C@@H]3C2 |
| InChI | InChI=1S/C43H63N3O7/c1-28(49)24-45-25-36-35-23-37(46-42(35)30-16-18-43(36)17-6-8-32(43)21-30)39(51)27-52-41-20-29(13-15-38(41)50)12-14-34-22-31(26-48)40(53-34)11-5-3-2-4-9-33(44)10-7-19-47/h13,15-16,18,20,22-23,28,30,32-33,36,39-40,45,47-49,51,53H,2-12,14,17,19,21,24-27,44H2,1H3/p+1/t28-,30-,32+,33-,36-,39-,40?,43+/m0/s1 |
| InChIKey | GVZRFRFZKKDTPS-BPHYVTELSA-O |
| XLogP | 4.74 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|