About 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium
4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium (PubChem CID 163176136) has the molecular formula C11H14NO+
and a molecular weight of 176.24 g/mol. Its IUPAC name is 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium.
Molecular Properties
| Compound Name | 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium |
| PubChem CID | 163176136 |
| Molecular Formula | C11H14NO+ |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium |
| SMILES | COC1=C2C=CC=CC2[NH+](C)C=C1 |
| InChI | InChI=1S/C11H13NO/c1-12-8-7-11(13-2)9-5-3-4-6-10(9)12/h3-8,10H,1-2H3/p+1 |
| InChIKey | OXLGIAHOINLSLY-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium?
The IUPAC name of 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium (CID 163176136) is 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium.
What is the SMILES notation for 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium?
The canonical SMILES for 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium is COC1=C2C=CC=CC2[NH+](C)C=C1.
What is the InChIKey of 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium?
The InChIKey is OXLGIAHOINLSLY-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H13NO/c1-12-8-7-11(13-2)9-5-3-4-6-10(9)12/h3-8,10H,1-2H3/p+1.
What are the key properties of 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium?
4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium has a molecular weight of 176.24 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-methyl-1,8a-dihydroquinolin-1-ium is sourced from PubChem (CID 163176136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).