C25H18Cl2N2O3 — CID 163176566
2-[(3R,5S,6S)-6-(3,5-dichloro-2-hydroxyphenyl)-5-phenyl-3,4,5,6-tetrahydropyridazin-3-yl]-3-hydroxyinden-1-one (PubChem CID 163176566) has the molecular formula C25H18Cl2N2O3 and a molecular weight of 465.34 g/mol. Its IUPAC name is 2-[(3R,5S,6S)-6-(3,5-dichloro-2-hydroxyphenyl)-5-phenyl-3,4,5,6-tetrahydropyridazin-3-yl]-3-hydroxyinden-1-one.
| Compound Name | 2-[(3R,5S,6S)-6-(3,5-dichloro-2-hydroxyphenyl)-5-phenyl-3,4,5,6-tetrahydropyridazin-3-yl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 163176566 |
| Molecular Formula | C25H18Cl2N2O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-[(3R,5S,6S)-6-(3,5-dichloro-2-hydroxyphenyl)-5-phenyl-3,4,5,6-tetrahydropyridazin-3-yl]-3-hydroxyinden-1-one |
| SMILES | O=C1C([C@H]2C[C@@H](c3ccccc3)[C@@H](c3cc(Cl)cc(Cl)c3O)N=N2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C25H18Cl2N2O3/c26-14-10-18(23(30)19(27)11-14)22-17(13-6-2-1-3-7-13)12-20(28-29-22)21-24(31)15-8-4-5-9-16(15)25(21)32/h1-11,17,20,22,30-31H,12H2/t17-,20+,22-/m0/s1 |
| InChIKey | XMHBTDQFTYLBER-WEYGHZABSA-N |
| XLogP | 6.91 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|