C27H32N2O10 — CID 163176786
(3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(4H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 163176786) has the molecular formula C27H32N2O10 and a molecular weight of 544.56 g/mol. Its IUPAC name is (3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(4H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | (3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(4H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 163176786 |
| Molecular Formula | C27H32N2O10 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(4H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | Cc1cc(=O)c2cc3c(c(N4C=C5N=CC=C5C4)c2o1)OC(C)(C)[C@H](OOC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C3 |
| InChI | InChI=1S/C27H32N2O10/c1-13-6-18(31)16-7-15-8-21(39-36-12-20(33)24(35)23(34)19(32)11-30)27(2,3)38-25(15)22(26(16)37-13)29-9-14-4-5-28-17(14)10-29/h4-7,10,19-21,23-24,30,32-35H,8-9,11-12H2,1-3H3/t19-,20+,21-,23-,24-/m1/s1 |
| InChIKey | XOJKSYSMWJPJDO-NJHHKMHKSA-N |
| XLogP | 0.24 |
| TPSA | 174.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|