C10H8F6N2O3 — CID 163176866
N-hydroxy-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]benzeneamine oxide (PubChem CID 163176866) has the molecular formula C10H8F6N2O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is N-hydroxy-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]benzeneamine oxide.
| Compound Name | N-hydroxy-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]benzeneamine oxide |
|---|---|
| PubChem CID | 163176866 |
| Molecular Formula | C10H8F6N2O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-hydroxy-2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]benzeneamine oxide |
| SMILES | O=C(Nc1ccccc1[NH+]([O-])O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2O3/c11-9(12,13)7(10(14,15)16)8(19)17-5-3-1-2-4-6(5)18(20)21/h1-4,7,18,20H,(H,17,19) |
| InChIKey | XPKXIDKGCSZKMM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|