C22H23O11+ — CID 163177708
[(2R,3S,4S,5R)-5-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2H-chromen-1-ium-3-yl]oxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 163177708) has the molecular formula C22H23O11+ and a molecular weight of 463.42 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2H-chromen-1-ium-3-yl]oxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-5-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2H-chromen-1-ium-3-yl]oxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163177708 |
| Molecular Formula | C22H23O11+ |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [(2R,3S,4S,5R)-5-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2H-chromen-1-ium-3-yl]oxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC2=Cc3c(O)cc(O)cc3[OH+]C2c2ccc(O)c(O)c2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H22O11/c1-9(23)30-8-18-19(28)20(29)22(33-18)32-17-7-12-14(26)5-11(24)6-16(12)31-21(17)10-2-3-13(25)15(27)4-10/h2-7,18-22,24-29H,8H2,1H3/p+1/t18-,19-,20+,21?,22+/m1/s1 |
| InChIKey | XYDBMGNSWMSATP-QIKJAYGVSA-O |
| XLogP | 0.87 |
| TPSA | 178.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|