C35H44O11 — CID 163178173
[6,12-diacetyloxy-7-hydroxy-2,5,5,13-tetramethyl-9-methylidene-10-(2-methylpropanoyloxy)-15-oxo-14-oxatricyclo[9.3.1.11,13]hexadec-3-en-8-yl] benzoate (PubChem CID 163178173) has the molecular formula C35H44O11 and a molecular weight of 640.73 g/mol. Its IUPAC name is [6,12-diacetyloxy-7-hydroxy-2,5,5,13-tetramethyl-9-methylidene-10-(2-methylpropanoyloxy)-15-oxo-14-oxatricyclo[9.3.1.11,13]hexadec-3-en-8-yl] benzoate.
| Compound Name | [6,12-diacetyloxy-7-hydroxy-2,5,5,13-tetramethyl-9-methylidene-10-(2-methylpropanoyloxy)-15-oxo-14-oxatricyclo[9.3.1.11,13]hexadec-3-en-8-yl] benzoate |
|---|---|
| PubChem CID | 163178173 |
| Molecular Formula | C35H44O11 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | [6,12-diacetyloxy-7-hydroxy-2,5,5,13-tetramethyl-9-methylidene-10-(2-methylpropanoyloxy)-15-oxo-14-oxatricyclo[9.3.1.11,13]hexadec-3-en-8-yl] benzoate |
| SMILES | C=C1C(OC(=O)c2ccccc2)C(O)C(OC(C)=O)C(C)(C)C=CC(C)C23CC(C)(O2)C(OC(C)=O)C(C3=O)C1OC(=O)C(C)C |
| InChI | InChI=1S/C35H44O11/c1-18(2)31(40)44-26-20(4)27(45-32(41)23-13-11-10-12-14-23)25(38)30(43-22(6)37)33(7,8)16-15-19(3)35-17-34(9,46-35)29(42-21(5)36)24(26)28(35)39/h10-16,18-19,24-27,29-30,38H,4,17H2,1-3,5-9H3 |
| InChIKey | YCCNSZADCQXKKU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|