C18H16N3O4- — CID 163178179
1-[4-[hydroxy(oxido)amino]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 163178179) has the molecular formula C18H16N3O4- and a molecular weight of 338.34 g/mol. Its IUPAC name is 1-[4-[hydroxy(oxido)amino]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-[4-[hydroxy(oxido)amino]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 163178179 |
| Molecular Formula | C18H16N3O4- |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[4-[hydroxy(oxido)amino]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)C(c2ccc(N([O-])O)cc2)N1 |
| InChI | InChI=1S/C18H16N3O4/c22-18(23)15-9-13-12-3-1-2-4-14(12)19-17(13)16(20-15)10-5-7-11(8-6-10)21(24)25/h1-8,15-16,19-20,24H,9H2,(H,22,23)/q-1 |
| InChIKey | BHBYBDCQKCPPSJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|