C38H53N3O5 — CID 163178851
CID 163178851 (PubChem CID 163178851) has the molecular formula C38H53N3O5 and a molecular weight of 631.86 g/mol.
| Compound Name | CID 163178851 |
|---|---|
| PubChem CID | 163178851 |
| Molecular Formula | C38H53N3O5 |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.40 |
| IUPAC Name | — |
| SMILES | CCCCC1OC(CCc2ccc(O)c(OC[C@H](NC)[C+]3C=C4C(=N3)[C@H]3C=C[C@@]5(CCC[C@@H]5C3)[C@@H]4CNC[C@H](C)O)c2)=C[C-]1CO |
| InChI | InChI=1S/C38H53N3O5/c1-4-5-8-35-27(22-42)18-29(46-35)11-9-25-10-12-34(44)36(16-25)45-23-33(39-3)32-19-30-31(21-40-20-24(2)43)38-14-6-7-28(38)17-26(13-15-38)37(30)41-32/h10,12-13,15-16,18-19,24,26,28,31,33,35,39-40,42-44H,4-9,11,14,17,20-23H2,1-3H3/t24-,26-,28+,31+,33-,35?,38+/m0/s1 |
| InChIKey | YIBQVEHSMUHICB-CXDOVLMUSA-N |
| XLogP | 5.21 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|