C27H48O6S — CID 163178911
[3,6-dihydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-yl] hydrogen sulfate (PubChem CID 163178911) has the molecular formula C27H48O6S and a molecular weight of 500.74 g/mol. Its IUPAC name is [3,6-dihydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-yl] hydrogen sulfate.
| Compound Name | [3,6-dihydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 163178911 |
| Molecular Formula | C27H48O6S |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | [3,6-dihydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-5-yl] hydrogen sulfate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC(O)C4(OS(=O)(=O)O)CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H48O6S/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24(29)27(33-34(30,31)32)16-19(28)11-14-26(27,5)23(20)12-13-25(21,22)4/h17-24,28-29H,6-16H2,1-5H3,(H,30,31,32) |
| InChIKey | YIMZBBJTOWZTEL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|