C25H34O3 — CID 163179970
4-(hydroxymethyl)-14-(7-hydroxy-6-methylhept-5-en-2-yl)-8,11-dimethyltetracyclo[9.3.0.01,5.05,9]tetradeca-3,7,13-trien-6-one (PubChem CID 163179970) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 4-(hydroxymethyl)-14-(7-hydroxy-6-methylhept-5-en-2-yl)-8,11-dimethyltetracyclo[9.3.0.01,5.05,9]tetradeca-3,7,13-trien-6-one.
| Compound Name | 4-(hydroxymethyl)-14-(7-hydroxy-6-methylhept-5-en-2-yl)-8,11-dimethyltetracyclo[9.3.0.01,5.05,9]tetradeca-3,7,13-trien-6-one |
|---|---|
| PubChem CID | 163179970 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4-(hydroxymethyl)-14-(7-hydroxy-6-methylhept-5-en-2-yl)-8,11-dimethyltetracyclo[9.3.0.01,5.05,9]tetradeca-3,7,13-trien-6-one |
| SMILES | CC(=CCCC(C)C1=CCC2(C)CC3C(C)=CC(=O)C34C(CO)=CCC124)CO |
| InChI | InChI=1S/C25H34O3/c1-16(14-26)6-5-7-17(2)20-9-10-23(4)13-21-18(3)12-22(28)25(21)19(15-27)8-11-24(20,23)25/h6,8-9,12,17,21,26-27H,5,7,10-11,13-15H2,1-4H3 |
| InChIKey | YSOIQLPFZKORKR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|