C28H25NO2 — CID 163181819
(3aR,4S,7R,7aS)-2-(2,4-dimethylphenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 163181819) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-(2,4-dimethylphenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-(2,4-dimethylphenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 163181819 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-(2,4-dimethylphenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H](c2ccccc2)C=C[C@H]3c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H25NO2/c1-18-13-16-24(19(2)17-18)29-27(30)25-22(20-9-5-3-6-10-20)14-15-23(26(25)28(29)31)21-11-7-4-8-12-21/h3-17,22-23,25-26H,1-2H3/t22-,23+,25-,26+ |
| InChIKey | ZKCYYMMKCWZZJI-DXNCEWNXSA-N |
| XLogP | 5.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|