About 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide
1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide (PubChem CID 163181945) has the molecular formula C22H16N2O8
and a molecular weight of 436.38 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide.
Molecular Properties
| Compound Name | 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide |
| PubChem CID | 163181945 |
| Molecular Formula | C22H16N2O8 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide |
| SMILES | O=C(Oc1c(-c2ccccc2)oc2ccccc2c1=O)c1cc([NH+]([O-])O)cc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C22H16N2O8/c25-19-17-8-4-5-9-18(17)31-20(13-6-2-1-3-7-13)21(19)32-22(26)14-10-15(23(27)28)12-16(11-14)24(29)30/h1-12,23-24,27,29H |
| InChIKey | ZLLKEDPZXZTNHW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide?
The IUPAC name of 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide (CID 163181945) is 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide.
What is the SMILES notation for 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide?
The canonical SMILES for 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide is O=C(Oc1c(-c2ccccc2)oc2ccccc2c1=O)c1cc([NH+]([O-])O)cc([NH+]([O-])O)c1.
What is the InChIKey of 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide?
The InChIKey is ZLLKEDPZXZTNHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O8/c25-19-17-8-4-5-9-18(17)31-20(13-6-2-1-3-7-13)21(19)32-22(26)14-10-15(23(27)28)12-16(11-14)24(29)30/h1-12,23-24,27,29H.
What are the key properties of 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide?
1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide has a molecular weight of 436.38 g/mol, XLogP of 1.49, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-dihydroxy-5-(4-oxo-2-phenylchromen-3-yl)oxycarbonylbenzene-1,3-diamine oxide is sourced from PubChem (CID 163181945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).