C18H23N2O6+ — CID 163182364
[(2E)-2-[(2S)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethyl]-[2-(4-hydroxy-3-methoxyphenyl)ethyl]azanium (PubChem CID 163182364) has the molecular formula C18H23N2O6+ and a molecular weight of 363.39 g/mol. Its IUPAC name is [(2E)-2-[(2S)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethyl]-[2-(4-hydroxy-3-methoxyphenyl)ethyl]azanium.
| Compound Name | [(2E)-2-[(2S)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethyl]-[2-(4-hydroxy-3-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 163182364 |
| Molecular Formula | C18H23N2O6+ |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [(2E)-2-[(2S)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethyl]-[2-(4-hydroxy-3-methoxyphenyl)ethyl]azanium |
| SMILES | COc1cc(CC[NH2+]C/C=C2/C=C(C(=O)O)N[C@H](C(=O)O)C2)ccc1O |
| InChI | InChI=1S/C18H22N2O6/c1-26-16-10-11(2-3-15(16)21)4-6-19-7-5-12-8-13(17(22)23)20-14(9-12)18(24)25/h2-3,5,8,10,14,19-21H,4,6-7,9H2,1H3,(H,22,23)(H,24,25)/p+1/b12-5-/t14-/m0/s1 |
| InChIKey | UFDRSQKALSEUEH-VDFGQWLZSA-O |
| XLogP | -0.15 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|