C31H38N2O10 — CID 163182671
(2R,3R)-2-cyclopentyl-2,8-dimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(1H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 163182671) has the molecular formula C31H38N2O10 and a molecular weight of 598.65 g/mol. Its IUPAC name is (2R,3R)-2-cyclopentyl-2,8-dimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(1H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | (2R,3R)-2-cyclopentyl-2,8-dimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(1H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 163182671 |
| Molecular Formula | C31H38N2O10 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | (2R,3R)-2-cyclopentyl-2,8-dimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-10-(1H-pyrrolo[3,4-b]pyrrol-5-yl)-3,4-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | Cc1cc(=O)c2cc3c(c(-n4cc5cc[nH]c5c4)c2o1)O[C@](C)(C1CCCC1)[C@H](OOC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C3 |
| InChI | InChI=1S/C31H38N2O10/c1-16-9-22(35)20-10-18-11-25(43-40-15-24(37)28(39)27(38)23(36)14-34)31(2,19-5-3-4-6-19)42-29(18)26(30(20)41-16)33-12-17-7-8-32-21(17)13-33/h7-10,12-13,19,23-25,27-28,32,34,36-39H,3-6,11,14-15H2,1-2H3/t23-,24+,25-,27-,28-,31-/m1/s1 |
| InChIKey | ZSXDXNWKGQIENR-ARXQMILRSA-N |
| XLogP | 2.01 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|