C18H16NO7+ — CID 163182722
[5-(carboxymethyl)-8-methoxynaphtho[2,1-g][1,3]benzodioxol-6-yl]-dihydroxyazanium (PubChem CID 163182722) has the molecular formula C18H16NO7+ and a molecular weight of 358.33 g/mol. Its IUPAC name is [5-(carboxymethyl)-8-methoxynaphtho[2,1-g][1,3]benzodioxol-6-yl]-dihydroxyazanium.
| Compound Name | [5-(carboxymethyl)-8-methoxynaphtho[2,1-g][1,3]benzodioxol-6-yl]-dihydroxyazanium |
|---|---|
| PubChem CID | 163182722 |
| Molecular Formula | C18H16NO7+ |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [5-(carboxymethyl)-8-methoxynaphtho[2,1-g][1,3]benzodioxol-6-yl]-dihydroxyazanium |
| SMILES | COc1cccc2c1cc([NH+](O)O)c1c(CC(=O)O)cc3c(c12)OCO3 |
| InChI | InChI=1S/C18H15NO7/c1-24-13-4-2-3-10-11(13)7-12(19(22)23)16-9(6-15(20)21)5-14-18(17(10)16)26-8-25-14/h2-5,7,22-23H,6,8H2,1H3,(H,20,21)/p+1 |
| InChIKey | KJVFWVNJUGYZKU-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|