C29H36N10O7 — CID 163183370
methyl 6-[4-[[amino-[2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]methylidene]amino]butylcarbamoylamino]-4-hydroxynaphthalene-2-carboxylate (PubChem CID 163183370) has the molecular formula C29H36N10O7 and a molecular weight of 636.67 g/mol. Its IUPAC name is methyl 6-[4-[[amino-[2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]methylidene]amino]butylcarbamoylamino]-4-hydroxynaphthalene-2-carboxylate.
| Compound Name | methyl 6-[4-[[amino-[2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]methylidene]amino]butylcarbamoylamino]-4-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 163183370 |
| Molecular Formula | C29H36N10O7 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | methyl 6-[4-[[amino-[2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylamino]methylidene]amino]butylcarbamoylamino]-4-hydroxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(O)c2cc(NC(=O)NCCCC/N=C(\N)NCC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)ccc2c1 |
| InChI | InChI=1S/C29H36N10O7/c1-45-27(43)16-10-15-4-5-17(12-18(15)19(40)11-16)38-29(44)34-8-3-2-7-32-28(31)33-9-6-20-22(41)23(42)26(46-20)39-14-37-21-24(30)35-13-36-25(21)39/h4-5,10-14,20,22-23,26,40-42H,2-3,6-9H2,1H3,(H2,30,35,36)(H3,31,32,33)(H2,34,38,44)/t20-,22-,23-,26-/m1/s1 |
| InChIKey | QVOKJKWHZRTVQQ-HUBRGWSESA-N |
| XLogP | 0.57 |
| TPSA | 257.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|