About 2,2-dicyclohexylpiperidine
2,2-dicyclohexylpiperidine (PubChem CID 163183548) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is 2,2-dicyclohexylpiperidine.
Molecular Properties
| Compound Name | 2,2-dicyclohexylpiperidine |
| PubChem CID | 163183548 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 2,2-dicyclohexylpiperidine |
| SMILES | C1CCC(C2(C3CCCCC3)CCCCN2)CC1 |
| InChI | InChI=1S/C17H31N/c1-3-9-15(10-4-1)17(13-7-8-14-18-17)16-11-5-2-6-12-16/h15-16,18H,1-14H2 |
| InChIKey | XMBXKTBMBRLSFS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dicyclohexylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclohexylpiperidine?
The IUPAC name of 2,2-dicyclohexylpiperidine (CID 163183548) is 2,2-dicyclohexylpiperidine.
What is the SMILES notation for 2,2-dicyclohexylpiperidine?
The canonical SMILES for 2,2-dicyclohexylpiperidine is C1CCC(C2(C3CCCCC3)CCCCN2)CC1.
What is the InChIKey of 2,2-dicyclohexylpiperidine?
The InChIKey is XMBXKTBMBRLSFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N/c1-3-9-15(10-4-1)17(13-7-8-14-18-17)16-11-5-2-6-12-16/h15-16,18H,1-14H2.
What are the key properties of 2,2-dicyclohexylpiperidine?
2,2-dicyclohexylpiperidine has a molecular weight of 249.44 g/mol, XLogP of 4.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclohexylpiperidine is sourced from PubChem (CID 163183548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).