C13H25NO5Si — CID 163183585
(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 163183585) has the molecular formula C13H25NO5Si and a molecular weight of 303.43 g/mol. Its IUPAC name is (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 163183585 |
| Molecular Formula | C13H25NO5Si |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-methoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)N1CC(O[Si](C)(C)C(C)(C)C)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H25NO5Si/c1-13(2,3)20(5,6)19-9-7-10(11(15)16)14(8-9)12(17)18-4/h9-10H,7-8H2,1-6H3,(H,15,16)/t9?,10-/m1/s1 |
| InChIKey | LVSGWPSATDCKPD-QVDQXJPCSA-N |
| XLogP | 2.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|