C21H17N3O7 — CID 163183715
(9E)-9-[hydroxy-(4-methoxyphenyl)methylidene]-6-[2-(hydroxymethyl)phenyl]-1,3,6-triazaspiro[4.4]nonane-2,4,7,8-tetrone (PubChem CID 163183715) has the molecular formula C21H17N3O7 and a molecular weight of 423.38 g/mol. Its IUPAC name is (9E)-9-[hydroxy-(4-methoxyphenyl)methylidene]-6-[2-(hydroxymethyl)phenyl]-1,3,6-triazaspiro[4.4]nonane-2,4,7,8-tetrone.
| Compound Name | (9E)-9-[hydroxy-(4-methoxyphenyl)methylidene]-6-[2-(hydroxymethyl)phenyl]-1,3,6-triazaspiro[4.4]nonane-2,4,7,8-tetrone |
|---|---|
| PubChem CID | 163183715 |
| Molecular Formula | C21H17N3O7 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (9E)-9-[hydroxy-(4-methoxyphenyl)methylidene]-6-[2-(hydroxymethyl)phenyl]-1,3,6-triazaspiro[4.4]nonane-2,4,7,8-tetrone |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccccc3CO)C23NC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C21H17N3O7/c1-31-13-8-6-11(7-9-13)16(26)15-17(27)18(28)24(14-5-3-2-4-12(14)10-25)21(15)19(29)22-20(30)23-21/h2-9,25-26H,10H2,1H3,(H2,22,23,29,30)/b16-15- |
| InChIKey | YFYQOTJJPYUOOR-NXVVXOECSA-N |
| XLogP | 0.61 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|