C27H21ClFe2O2 — CID 163183723
bis(cyclopenta-1,3-diene);cyclopenta-2,4-dien-1-yl 2-chloro-4-cyclopenta-2,4-dien-1-ylbenzoate;bis(iron(2+)) (PubChem CID 163183723) has the molecular formula C27H21ClFe2O2 and a molecular weight of 524.61 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);cyclopenta-2,4-dien-1-yl 2-chloro-4-cyclopenta-2,4-dien-1-ylbenzoate;bis(iron(2+)).
| Compound Name | bis(cyclopenta-1,3-diene);cyclopenta-2,4-dien-1-yl 2-chloro-4-cyclopenta-2,4-dien-1-ylbenzoate;bis(iron(2+)) |
|---|---|
| PubChem CID | 163183723 |
| Molecular Formula | C27H21ClFe2O2 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | bis(cyclopenta-1,3-diene);cyclopenta-2,4-dien-1-yl 2-chloro-4-cyclopenta-2,4-dien-1-ylbenzoate;bis(iron(2+)) |
| SMILES | O=C(O[c-]1cccc1)c1ccc(-[c-]2cccc2)cc1Cl.[Fe+2].[Fe+2].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C17H11ClO2.2C5H5.2Fe/c18-16-11-13(12-5-1-2-6-12)9-10-15(16)17(19)20-14-7-3-4-8-14;2*1-2-4-5-3-1;;/h1-11H;2*1-5H;;/q-2;2*-1;2*+2 |
| InChIKey | BGXIYDCTJQRGNJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|