C21H34O8 — CID 163183906
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-4-[(1R)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 163183906) has the molecular formula C21H34O8 and a molecular weight of 414.50 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-4-[(1R)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-4-[(1R)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163183906 |
| Molecular Formula | C21H34O8 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-4-[(1R)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H](C)CC[C@H]2C(C)=CC(=O)CC2(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H34O8/c1-11-8-14(23)9-21(4,5)15(11)7-6-12(2)28-20-19(26)18(25)17(24)16(29-20)10-27-13(3)22/h8,12,15-20,24-26H,6-7,9-10H2,1-5H3/t12-,15-,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | ACFLLXXBYKCGOS-UOGKLMMRSA-N |
| XLogP | 1.10 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |