About (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate
(3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate (PubChem CID 163184244) has the molecular formula C29H42O5
and a molecular weight of 470.65 g/mol. Its IUPAC name is (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate.
Molecular Properties
| Compound Name | (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate |
| PubChem CID | 163184244 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC1(C)C(=O)C=C2C=C(C)OC=C2C1=O |
| InChI | InChI=1S/C29H42O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(31)34-29(3)26(30)21-24-20-23(2)33-22-25(24)28(29)32/h11-12,20-22H,4-10,13-19H2,1-3H3/b12-11+ |
| InChIKey | IBSPQJYONRFSNR-VAWYXSNFSA-N |
| XLogP | 7.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate?
The IUPAC name of (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate (CID 163184244) is (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate.
What is the SMILES notation for (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate?
The canonical SMILES for (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate is CCCCCCCC/C=C/CCCCCCCC(=O)OC1(C)C(=O)C=C2C=C(C)OC=C2C1=O.
What is the InChIKey of (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate?
The InChIKey is IBSPQJYONRFSNR-VAWYXSNFSA-N. The full InChI is InChI=1S/C29H42O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(31)34-29(3)26(30)21-24-20-23(2)33-22-25(24)28(29)32/h11-12,20-22H,4-10,13-19H2,1-3H3/b12-11+.
What are the key properties of (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate?
(3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate has a molecular weight of 470.65 g/mol, XLogP of 7.22, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (E)-octadec-9-enoate is sourced from PubChem (CID 163184244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).