C24H32O7 — CID 163184318
(Z,4R,7Z)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid (PubChem CID 163184318) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is (Z,4R,7Z)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid.
| Compound Name | (Z,4R,7Z)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid |
|---|---|
| PubChem CID | 163184318 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (Z,4R,7Z)-4-acetyloxy-7-[(2S)-2-acetyloxy-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid |
| SMILES | CCCCC/C=C\C[C@]1(OC(C)=O)C=CC(=O)/C1=C\C=C/[C@@H](CCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C24H32O7/c1-4-5-6-7-8-9-16-24(31-19(3)26)17-15-22(27)21(24)12-10-11-20(30-18(2)25)13-14-23(28)29/h8-12,15,17,20H,4-7,13-14,16H2,1-3H3,(H,28,29)/b9-8-,11-10-,21-12+/t20-,24-/m0/s1 |
| InChIKey | HFAAZEPLFUTAKQ-IKOTYBJSSA-N |
| XLogP | 4.23 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|