C22H30O6 — CID 163184440
(2Z,6E)-2-[(Z)-5-acetyloxy-4-methylpent-3-enyl]-6-methyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dienoic acid (PubChem CID 163184440) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2Z,6E)-2-[(Z)-5-acetyloxy-4-methylpent-3-enyl]-6-methyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dienoic acid.
| Compound Name | (2Z,6E)-2-[(Z)-5-acetyloxy-4-methylpent-3-enyl]-6-methyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dienoic acid |
|---|---|
| PubChem CID | 163184440 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (2Z,6E)-2-[(Z)-5-acetyloxy-4-methylpent-3-enyl]-6-methyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dienoic acid |
| SMILES | CC(=O)OC/C(C)=C\CC/C(=C/CC/C(C)=C/CCC1=CC(=O)OC1)C(=O)O |
| InChI | InChI=1S/C22H30O6/c1-16(7-4-10-19-13-21(24)28-15-19)8-5-11-20(22(25)26)12-6-9-17(2)14-27-18(3)23/h7,9,11,13H,4-6,8,10,12,14-15H2,1-3H3,(H,25,26)/b16-7+,17-9-,20-11- |
| InChIKey | RTVZIYCFNOJLDA-ABUXYODESA-N |
| XLogP | 4.28 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|