C40H60 — CID 163184446
2-[(1E,3E,5E,7E,9E,11E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,15,19,23-nonaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 163184446) has the molecular formula C40H60 and a molecular weight of 540.92 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E,9E,11E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,15,19,23-nonaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E,9E,11E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,15,19,23-nonaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 163184446 |
| Molecular Formula | C40H60 |
| Molecular Weight | 540.92 g/mol |
| Exact Mass | 540.47 |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E,11E,15E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,15,19,23-nonaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H60/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-12,16,18-20,23-25,27,29-30H,13-15,17,21-22,26,28,31H2,1-10H3/b12-11+,23-16+,30-29+,33-19+,34-20+,35-24+,36-25+,37-27+ |
| InChIKey | CJPVGWWWFOEZJV-FOBJUVIXSA-N |
| XLogP | 13.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.92 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|