C14H22O7 — CID 163185021
(1S,2R,4S,6S,7S,9S,10R,11R)-2,9-dimethoxy-6,11-dimethyl-5,8,12-trioxatetracyclo[7.3.1.02,7.07,11]tridecane-4,10-diol (PubChem CID 163185021) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is (1S,2R,4S,6S,7S,9S,10R,11R)-2,9-dimethoxy-6,11-dimethyl-5,8,12-trioxatetracyclo[7.3.1.02,7.07,11]tridecane-4,10-diol.
| Compound Name | (1S,2R,4S,6S,7S,9S,10R,11R)-2,9-dimethoxy-6,11-dimethyl-5,8,12-trioxatetracyclo[7.3.1.02,7.07,11]tridecane-4,10-diol |
|---|---|
| PubChem CID | 163185021 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (1S,2R,4S,6S,7S,9S,10R,11R)-2,9-dimethoxy-6,11-dimethyl-5,8,12-trioxatetracyclo[7.3.1.02,7.07,11]tridecane-4,10-diol |
| SMILES | CO[C@]12C[C@@H]3O[C@](C)([C@H]1O)[C@@]1(O2)[C@H](C)O[C@H](O)C[C@@]31OC |
| InChI | InChI=1S/C14H22O7/c1-7-14-11(2)10(16)13(18-4,21-14)5-8(20-11)12(14,17-3)6-9(15)19-7/h7-10,15-16H,5-6H2,1-4H3/t7-,8-,9-,10+,11+,12+,13-,14-/m0/s1 |
| InChIKey | IKYAAPKEBRREBQ-OQWAIJLPSA-N |
| XLogP | -0.47 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |