C21H26N2O3 — CID 163185041
methyl (1S,2S,11S,12R,16Z)-2-ethyl-16-ethylidene-11-(hydroxymethyl)-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-3,5,7,9-tetraene-11-carboxylate (PubChem CID 163185041) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl (1S,2S,11S,12R,16Z)-2-ethyl-16-ethylidene-11-(hydroxymethyl)-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-3,5,7,9-tetraene-11-carboxylate.
| Compound Name | methyl (1S,2S,11S,12R,16Z)-2-ethyl-16-ethylidene-11-(hydroxymethyl)-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-3,5,7,9-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 163185041 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl (1S,2S,11S,12R,16Z)-2-ethyl-16-ethylidene-11-(hydroxymethyl)-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-3,5,7,9-tetraene-11-carboxylate |
| SMILES | C/C=C1/[C@H]2CCN[C@@H]1[C@@]1(CC)C(=Nc3ccccc31)[C@@]2(CO)C(=O)OC |
| InChI | InChI=1S/C21H26N2O3/c1-4-13-14-10-11-22-17(13)20(5-2)15-8-6-7-9-16(15)23-18(20)21(14,12-24)19(25)26-3/h4,6-9,14,17,22,24H,5,10-12H2,1-3H3/b13-4-/t14-,17+,20+,21+/m1/s1 |
| InChIKey | CTIFWXHLJCBKTR-VOHAUTBLSA-N |
| XLogP | 2.51 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|