C17H28O5 — CID 163185042
(5R,6E,8S,9E,13S,14R)-4,5,8-trihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one (PubChem CID 163185042) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (5R,6E,8S,9E,13S,14R)-4,5,8-trihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one.
| Compound Name | (5R,6E,8S,9E,13S,14R)-4,5,8-trihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one |
|---|---|
| PubChem CID | 163185042 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (5R,6E,8S,9E,13S,14R)-4,5,8-trihydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one |
| SMILES | C/C1=C\CC[C@H](C)[C@@H](C)OC(=O)CC(O)[C@](C)(O)/C=C/[C@@H]1O |
| InChI | InChI=1S/C17H28O5/c1-11-6-5-7-12(2)14(18)8-9-17(4,21)15(19)10-16(20)22-13(11)3/h7-9,11,13-15,18-19,21H,5-6,10H2,1-4H3/b9-8+,12-7+/t11-,13+,14-,15?,17+/m0/s1 |
| InChIKey | CXVNCHBZRJUHRL-KCWQPYEESA-N |
| XLogP | 1.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|