C14H24O3 — CID 163185311
(1R,4S,6R,7R,8S,11S)-4-methyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol (PubChem CID 163185311) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1R,4S,6R,7R,8S,11S)-4-methyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol.
| Compound Name | (1R,4S,6R,7R,8S,11S)-4-methyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol |
|---|---|
| PubChem CID | 163185311 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1R,4S,6R,7R,8S,11S)-4-methyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-ol |
| SMILES | CC(C)[C@@H]1CC[C@@H]2O[C@@H]2CC[C@]2(C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C14H24O3/c1-8(2)9-4-5-10-11(16-10)6-7-14(3)13(17-14)12(9)15/h8-13,15H,4-7H2,1-3H3/t9-,10-,11+,12+,13+,14-/m0/s1 |
| InChIKey | IYCWKHGQZIXBBY-KKKKKVIPSA-N |
| XLogP | 2.12 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|